| Size | 100g |
|---|---|
| Brand | BioFM |
| Common Name | diethyl decanedioate |
| MPN | ETSEBAC |
| Country/Region of Manufacture | United States |
| Preferred IUPAC Name | decanedioic acid, diethyl ester |
| Intended Use/Discipline | Biological Laboratory, Cosmetology |
Check the listing for details. Diethyl sebacate. Condition: New. Listed at 41.35 USD. Synonym: sebacic acid ethyl ester, sebacic acid diethyl ester; diethyl decanedioate; decanedioic acid, diethyl ester, ethyl sebacate. SMILES: CCOC(=O)CCCCCCCCC(=O)OCC. HS Code: 293499. MW: 258.35g/mol.